C35H60O6 — CID 157006438
[(2S)-3-hydroxy-2-(10-methylundecanoyloxy)propyl] (5Z,8Z,11Z,14Z,18S)-18-hydroxyicosa-5,8,11,14-tetraenoate (PubChem CID 157006438) has the molecular formula C35H60O6 and a molecular weight of 576.86 g/mol. Its IUPAC name is [(2S)-3-hydroxy-2-(10-methylundecanoyloxy)propyl] (5Z,8Z,11Z,14Z,18S)-18-hydroxyicosa-5,8,11,14-tetraenoate.
| Compound Name | [(2S)-3-hydroxy-2-(10-methylundecanoyloxy)propyl] (5Z,8Z,11Z,14Z,18S)-18-hydroxyicosa-5,8,11,14-tetraenoate |
|---|---|
| PubChem CID | 157006438 |
| Molecular Formula | C35H60O6 |
| Molecular Weight | 576.86 g/mol |
| Exact Mass | 576.44 |
| IUPAC Name | [(2S)-3-hydroxy-2-(10-methylundecanoyloxy)propyl] (5Z,8Z,11Z,14Z,18S)-18-hydroxyicosa-5,8,11,14-tetraenoate |
| SMILES | CC[C@H](O)CC/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)OC[C@H](CO)OC(=O)CCCCCCCCC(C)C |
| InChI | InChI=1S/C35H60O6/c1-4-32(37)26-22-18-13-11-9-7-5-6-8-10-12-14-19-23-27-34(38)40-30-33(29-36)41-35(39)28-24-20-16-15-17-21-25-31(2)3/h6-9,12-14,18,31-33,36-37H,4-5,10-11,15-17,19-30H2,1-3H3/b8-6-,9-7-,14-12-,18-13-/t32-,33-/m0/s1 |
| InChIKey | GRNSCGRNRAGQGO-GXIMAFOCSA-N |
| XLogP | 8.33 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.86 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|