C35H60O8 — CID 157006472
[(2S)-2-hydroxy-3-[(Z)-7-[(1R,2R,5S)-5-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-3-oxocyclopentyl]hept-5-enoyl]oxypropyl] 10-methylundecanoate (PubChem CID 157006472) has the molecular formula C35H60O8 and a molecular weight of 608.86 g/mol. Its IUPAC name is [(2S)-2-hydroxy-3-[(Z)-7-[(1R,2R,5S)-5-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-3-oxocyclopentyl]hept-5-enoyl]oxypropyl] 10-methylundecanoate.
| Compound Name | [(2S)-2-hydroxy-3-[(Z)-7-[(1R,2R,5S)-5-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-3-oxocyclopentyl]hept-5-enoyl]oxypropyl] 10-methylundecanoate |
|---|---|
| PubChem CID | 157006472 |
| Molecular Formula | C35H60O8 |
| Molecular Weight | 608.86 g/mol |
| Exact Mass | 608.43 |
| IUPAC Name | [(2S)-2-hydroxy-3-[(Z)-7-[(1R,2R,5S)-5-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-3-oxocyclopentyl]hept-5-enoyl]oxypropyl] 10-methylundecanoate |
| SMILES | CCCCC[C@H](O)/C=C/[C@H]1C(=O)C[C@H](O)[C@@H]1C/C=C\CCCC(=O)OC[C@@H](O)COC(=O)CCCCCCCCC(C)C |
| InChI | InChI=1S/C35H60O8/c1-4-5-12-18-28(36)22-23-31-30(32(38)24-33(31)39)19-14-10-11-16-21-35(41)43-26-29(37)25-42-34(40)20-15-9-7-6-8-13-17-27(2)3/h10,14,22-23,27-32,36-38H,4-9,11-13,15-21,24-26H2,1-3H3/b14-10-,23-22+/t28-,29-,30+,31+,32-/m0/s1 |
| InChIKey | KAXOKEDGAICQCD-BJTXCJSMSA-N |
| XLogP | 6.39 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.86 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|