C36H62O8 — CID 157006678
[(2R)-2-hydroxy-3-[(Z)-7-[(1R,2R,5S)-5-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-3-oxocyclopentyl]hept-5-enoyl]oxypropyl] 11-methyldodecanoate (PubChem CID 157006678) has the molecular formula C36H62O8 and a molecular weight of 622.88 g/mol. Its IUPAC name is [(2R)-2-hydroxy-3-[(Z)-7-[(1R,2R,5S)-5-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-3-oxocyclopentyl]hept-5-enoyl]oxypropyl] 11-methyldodecanoate.
| Compound Name | [(2R)-2-hydroxy-3-[(Z)-7-[(1R,2R,5S)-5-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-3-oxocyclopentyl]hept-5-enoyl]oxypropyl] 11-methyldodecanoate |
|---|---|
| PubChem CID | 157006678 |
| Molecular Formula | C36H62O8 |
| Molecular Weight | 622.88 g/mol |
| Exact Mass | 622.44 |
| IUPAC Name | [(2R)-2-hydroxy-3-[(Z)-7-[(1R,2R,5S)-5-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-3-oxocyclopentyl]hept-5-enoyl]oxypropyl] 11-methyldodecanoate |
| SMILES | CCCCC[C@H](O)/C=C/[C@H]1C(=O)C[C@H](O)[C@@H]1C/C=C\CCCC(=O)OC[C@H](O)COC(=O)CCCCCCCCCC(C)C |
| InChI | InChI=1S/C36H62O8/c1-4-5-13-19-29(37)23-24-32-31(33(39)25-34(32)40)20-15-11-12-17-22-36(42)44-27-30(38)26-43-35(41)21-16-10-8-6-7-9-14-18-28(2)3/h11,15,23-24,28-33,37-39H,4-10,12-14,16-22,25-27H2,1-3H3/b15-11-,24-23+/t29-,30+,31+,32+,33-/m0/s1 |
| InChIKey | GZBAHCIUDWUYCB-UFLJZKCYSA-N |
| XLogP | 6.78 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.88 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|