C35H62O7 — CID 157006503
[(2R)-2-hydroxy-3-(10-methylundecanoyloxy)propyl] (8Z,11Z,14Z)-5,6-dihydroxyicosa-8,11,14-trienoate (PubChem CID 157006503) has the molecular formula C35H62O7 and a molecular weight of 594.87 g/mol. Its IUPAC name is [(2R)-2-hydroxy-3-(10-methylundecanoyloxy)propyl] (8Z,11Z,14Z)-5,6-dihydroxyicosa-8,11,14-trienoate.
| Compound Name | [(2R)-2-hydroxy-3-(10-methylundecanoyloxy)propyl] (8Z,11Z,14Z)-5,6-dihydroxyicosa-8,11,14-trienoate |
|---|---|
| PubChem CID | 157006503 |
| Molecular Formula | C35H62O7 |
| Molecular Weight | 594.87 g/mol |
| Exact Mass | 594.45 |
| IUPAC Name | [(2R)-2-hydroxy-3-(10-methylundecanoyloxy)propyl] (8Z,11Z,14Z)-5,6-dihydroxyicosa-8,11,14-trienoate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\CC(O)C(O)CCCC(=O)OC[C@H](O)COC(=O)CCCCCCCCC(C)C |
| InChI | InChI=1S/C35H62O7/c1-4-5-6-7-8-9-10-11-12-13-17-20-24-32(37)33(38)25-22-27-35(40)42-29-31(36)28-41-34(39)26-21-18-15-14-16-19-23-30(2)3/h8-9,11-12,17,20,30-33,36-38H,4-7,10,13-16,18-19,21-29H2,1-3H3/b9-8-,12-11-,20-17-/t31-,32?,33?/m1/s1 |
| InChIKey | OIRWASXEJXIFGR-ORHILHFRSA-N |
| XLogP | 7.52 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.87 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|