C33H58O6 — CID 157006521
[(2S)-1-hydroxy-3-(10-methylundecanoyloxy)propan-2-yl] (9Z,11E)-13-oxooctadeca-9,11-dienoate (PubChem CID 157006521) has the molecular formula C33H58O6 and a molecular weight of 550.82 g/mol. Its IUPAC name is [(2S)-1-hydroxy-3-(10-methylundecanoyloxy)propan-2-yl] (9Z,11E)-13-oxooctadeca-9,11-dienoate.
| Compound Name | [(2S)-1-hydroxy-3-(10-methylundecanoyloxy)propan-2-yl] (9Z,11E)-13-oxooctadeca-9,11-dienoate |
|---|---|
| PubChem CID | 157006521 |
| Molecular Formula | C33H58O6 |
| Molecular Weight | 550.82 g/mol |
| Exact Mass | 550.42 |
| IUPAC Name | [(2S)-1-hydroxy-3-(10-methylundecanoyloxy)propan-2-yl] (9Z,11E)-13-oxooctadeca-9,11-dienoate |
| SMILES | CCCCCC(=O)/C=C/C=C\CCCCCCCC(=O)O[C@@H](CO)COC(=O)CCCCCCCCC(C)C |
| InChI | InChI=1S/C33H58O6/c1-4-5-17-23-30(35)24-19-14-9-7-6-8-10-16-21-26-33(37)39-31(27-34)28-38-32(36)25-20-15-12-11-13-18-22-29(2)3/h9,14,19,24,29,31,34H,4-8,10-13,15-18,20-23,25-28H2,1-3H3/b14-9-,24-19+/t31-/m0/s1 |
| InChIKey | NAVLCSOPMKZNCX-YPDLXMNOSA-N |
| XLogP | 8.20 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.82 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|