C34H60O6 — CID 157006725
[(2S)-3-hydroxy-2-(11-methyldodecanoyloxy)propyl] (10E,12Z)-9-oxooctadeca-10,12-dienoate (PubChem CID 157006725) has the molecular formula C34H60O6 and a molecular weight of 564.85 g/mol. Its IUPAC name is [(2S)-3-hydroxy-2-(11-methyldodecanoyloxy)propyl] (10E,12Z)-9-oxooctadeca-10,12-dienoate.
| Compound Name | [(2S)-3-hydroxy-2-(11-methyldodecanoyloxy)propyl] (10E,12Z)-9-oxooctadeca-10,12-dienoate |
|---|---|
| PubChem CID | 157006725 |
| Molecular Formula | C34H60O6 |
| Molecular Weight | 564.85 g/mol |
| Exact Mass | 564.44 |
| IUPAC Name | [(2S)-3-hydroxy-2-(11-methyldodecanoyloxy)propyl] (10E,12Z)-9-oxooctadeca-10,12-dienoate |
| SMILES | CCCCC/C=C\C=C\C(=O)CCCCCCCC(=O)OC[C@H](CO)OC(=O)CCCCCCCCCC(C)C |
| InChI | InChI=1S/C34H60O6/c1-4-5-6-7-9-14-19-24-31(36)25-20-15-12-17-21-26-33(37)39-29-32(28-35)40-34(38)27-22-16-11-8-10-13-18-23-30(2)3/h9,14,19,24,30,32,35H,4-8,10-13,15-18,20-23,25-29H2,1-3H3/b14-9-,24-19+/t32-/m0/s1 |
| InChIKey | ILKMXKNYDHWDPI-ZEWISKEJSA-N |
| XLogP | 8.59 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.85 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|