C37H60O6 — CID 157006576
[(2S)-1-hydroxy-3-(10-methylundecanoyloxy)propan-2-yl] (4Z,7Z,10Z,12E,16Z,19Z)-14-hydroxydocosa-4,7,10,12,16,19-hexaenoate (PubChem CID 157006576) has the molecular formula C37H60O6 and a molecular weight of 600.88 g/mol. Its IUPAC name is [(2S)-1-hydroxy-3-(10-methylundecanoyloxy)propan-2-yl] (4Z,7Z,10Z,12E,16Z,19Z)-14-hydroxydocosa-4,7,10,12,16,19-hexaenoate.
| Compound Name | [(2S)-1-hydroxy-3-(10-methylundecanoyloxy)propan-2-yl] (4Z,7Z,10Z,12E,16Z,19Z)-14-hydroxydocosa-4,7,10,12,16,19-hexaenoate |
|---|---|
| PubChem CID | 157006576 |
| Molecular Formula | C37H60O6 |
| Molecular Weight | 600.88 g/mol |
| Exact Mass | 600.44 |
| IUPAC Name | [(2S)-1-hydroxy-3-(10-methylundecanoyloxy)propan-2-yl] (4Z,7Z,10Z,12E,16Z,19Z)-14-hydroxydocosa-4,7,10,12,16,19-hexaenoate |
| SMILES | CC/C=C\C/C=C\CC(O)/C=C/C=C\C/C=C\C/C=C\CCC(=O)O[C@@H](CO)COC(=O)CCCCCCCCC(C)C |
| InChI | InChI=1S/C37H60O6/c1-4-5-6-7-17-22-27-34(39)28-23-18-12-10-8-9-11-13-20-25-30-37(41)43-35(31-38)32-42-36(40)29-24-19-15-14-16-21-26-33(2)3/h5-6,8-9,12-13,17-18,20,22-23,28,33-35,38-39H,4,7,10-11,14-16,19,21,24-27,29-32H2,1-3H3/b6-5-,9-8-,18-12-,20-13-,22-17-,28-23+/t34?,35-/m0/s1 |
| InChIKey | LQGCCOFTONZXPU-DKFSOOFVSA-N |
| XLogP | 8.66 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.88 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|