C20H30N6O12S3-2 — CID 157010208
CID 157010208 (PubChem CID 157010208) has the molecular formula C20H30N6O12S3-2 and a molecular weight of 642.69 g/mol.
| Compound Name | CID 157010208 |
|---|---|
| PubChem CID | 157010208 |
| Molecular Formula | C20H30N6O12S3-2 |
| Molecular Weight | 642.69 g/mol |
| Exact Mass | 642.11 |
| IUPAC Name | — |
| SMILES | [NH2+]C(CCC(=O)NC(CSSSCC(NC(=O)CCC([NH2+])C(=O)[O-])C(O)NCC(=O)[O-])C(=O)NCC(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C20H34N6O12S3/c21-9(19(35)36)1-3-13(27)25-11(17(33)23-5-15(29)30)7-39-41-40-8-12(18(34)24-6-16(31)32)26-14(28)4-2-10(22)20(37)38/h9-12,17,23,33H,1-8,21-22H2,(H,24,34)(H,25,27)(H,26,28)(H,29,30)(H,31,32)(H,35,36)(H,37,38)/q+2/p-4 |
| InChIKey | NSAUKEKJJDLNCB-UHFFFAOYSA-J |
| XLogP | -10.64 |
| TPSA | 330.68 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.69 |
| LogP ≤ 5 | -10.64 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|