C10H16N3O6S2 — CID 157010276
CID 157010276 (PubChem CID 157010276) has the molecular formula C10H16N3O6S2 and a molecular weight of 338.39 g/mol.
| Compound Name | CID 157010276 |
|---|---|
| PubChem CID | 157010276 |
| Molecular Formula | C10H16N3O6S2 |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | — |
| SMILES | [NH]C(CCC(=O)NC(CSS)C(=O)NCC(=O)O)C(=O)O |
| InChI | InChI=1S/C10H16N3O6S2/c11-5(10(18)19)1-2-7(14)13-6(4-21-20)9(17)12-3-8(15)16/h5-6,11,20H,1-4H2,(H,12,17)(H,13,14)(H,15,16)(H,18,19) |
| InChIKey | WEUSESWYFHHZTC-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 156.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|