C18H22ClN3O4 — CID 157010923
N-[4-(4-chlorophenyl)-5-(methoxymethyl)-1H-pyrazol-3-yl]-2-(oxolan-2-ylmethoxy)acetamide (PubChem CID 157010923) has the molecular formula C18H22ClN3O4 and a molecular weight of 379.84 g/mol. Its IUPAC name is N-[4-(4-chlorophenyl)-5-(methoxymethyl)-1H-pyrazol-3-yl]-2-(oxolan-2-ylmethoxy)acetamide.
| Compound Name | N-[4-(4-chlorophenyl)-5-(methoxymethyl)-1H-pyrazol-3-yl]-2-(oxolan-2-ylmethoxy)acetamide |
|---|---|
| PubChem CID | 157010923 |
| Molecular Formula | C18H22ClN3O4 |
| Molecular Weight | 379.84 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | N-[4-(4-chlorophenyl)-5-(methoxymethyl)-1H-pyrazol-3-yl]-2-(oxolan-2-ylmethoxy)acetamide |
| SMILES | COCc1[nH]nc(NC(=O)COCC2CCCO2)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H22ClN3O4/c1-24-10-15-17(12-4-6-13(19)7-5-12)18(22-21-15)20-16(23)11-25-9-14-3-2-8-26-14/h4-7,14H,2-3,8-11H2,1H3,(H2,20,21,22,23) |
| InChIKey | DJRYFFRQICJRFE-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 85.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.84 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |