C15H14F3N3O2 — CID 157013388
quinoxalin-6-yl-[4-(trifluoromethoxy)piperidin-1-yl]methanone (PubChem CID 157013388) has the molecular formula C15H14F3N3O2 and a molecular weight of 325.29 g/mol. Its IUPAC name is quinoxalin-6-yl-[4-(trifluoromethoxy)piperidin-1-yl]methanone.
| Compound Name | quinoxalin-6-yl-[4-(trifluoromethoxy)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 157013388 |
| Molecular Formula | C15H14F3N3O2 |
| Molecular Weight | 325.29 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | quinoxalin-6-yl-[4-(trifluoromethoxy)piperidin-1-yl]methanone |
| SMILES | O=C(c1ccc2nccnc2c1)N1CCC(OC(F)(F)F)CC1 |
| InChI | InChI=1S/C15H14F3N3O2/c16-15(17,18)23-11-3-7-21(8-4-11)14(22)10-1-2-12-13(9-10)20-6-5-19-12/h1-2,5-6,9,11H,3-4,7-8H2 |
| InChIKey | DBFDKNOQNCZERM-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.29 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |