C28H31F2N7O4 — CID 157015656
(2S,6R)-4-[2-(2,3-difluorophenyl)acetyl]-10-[3-(tetrazol-1-yl)propanoyl]-15-oxa-4,7,10-triazatricyclo[14.3.1.02,6]icosa-1(20),16,18-trien-8-one (PubChem CID 157015656) has the molecular formula C28H31F2N7O4 and a molecular weight of 567.60 g/mol. Its IUPAC name is (2S,6R)-4-[2-(2,3-difluorophenyl)acetyl]-10-[3-(tetrazol-1-yl)propanoyl]-15-oxa-4,7,10-triazatricyclo[14.3.1.02,6]icosa-1(20),16,18-trien-8-one.
| Compound Name | (2S,6R)-4-[2-(2,3-difluorophenyl)acetyl]-10-[3-(tetrazol-1-yl)propanoyl]-15-oxa-4,7,10-triazatricyclo[14.3.1.02,6]icosa-1(20),16,18-trien-8-one |
|---|---|
| PubChem CID | 157015656 |
| Molecular Formula | C28H31F2N7O4 |
| Molecular Weight | 567.60 g/mol |
| Exact Mass | 567.24 |
| IUPAC Name | (2S,6R)-4-[2-(2,3-difluorophenyl)acetyl]-10-[3-(tetrazol-1-yl)propanoyl]-15-oxa-4,7,10-triazatricyclo[14.3.1.02,6]icosa-1(20),16,18-trien-8-one |
| SMILES | O=C1CN(C(=O)CCn2cnnn2)CCCCOc2cccc(c2)[C@H]2CN(C(=O)Cc3cccc(F)c3F)C[C@@H]2N1 |
| InChI | InChI=1S/C28H31F2N7O4/c29-23-8-4-6-20(28(23)30)14-27(40)36-15-22-19-5-3-7-21(13-19)41-12-2-1-10-35(17-25(38)32-24(22)16-36)26(39)9-11-37-18-31-33-34-37/h3-8,13,18,22,24H,1-2,9-12,14-17H2,(H,32,38)/t22-,24+/m1/s1 |
| InChIKey | PQZRPXQHOXPGGW-VWNXMTODSA-N |
| XLogP | 1.70 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.60 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |