C22H24N2O3 — CID 157015677
9-benzyl-1-(3-hydroxybenzoyl)-1,9-diazaspiro[4.5]decan-10-one (PubChem CID 157015677) has the molecular formula C22H24N2O3 and a molecular weight of 364.44 g/mol. Its IUPAC name is 9-benzyl-1-(3-hydroxybenzoyl)-1,9-diazaspiro[4.5]decan-10-one.
| Compound Name | 9-benzyl-1-(3-hydroxybenzoyl)-1,9-diazaspiro[4.5]decan-10-one |
|---|---|
| PubChem CID | 157015677 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 9-benzyl-1-(3-hydroxybenzoyl)-1,9-diazaspiro[4.5]decan-10-one |
| SMILES | O=C(c1cccc(O)c1)N1CCCC12CCCN(Cc1ccccc1)C2=O |
| InChI | InChI=1S/C22H24N2O3/c25-19-10-4-9-18(15-19)20(26)24-14-6-12-22(24)11-5-13-23(21(22)27)16-17-7-2-1-3-8-17/h1-4,7-10,15,25H,5-6,11-14,16H2 |
| InChIKey | QNDSHMFJAQAVAO-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |