C23H25FN2O2 — CID 162625491
9-benzyl-1-(4-fluoro-3-methylbenzoyl)-1,9-diazaspiro[4.5]decan-10-one (PubChem CID 162625491) has the molecular formula C23H25FN2O2 and a molecular weight of 380.46 g/mol. Its IUPAC name is 9-benzyl-1-(4-fluoro-3-methylbenzoyl)-1,9-diazaspiro[4.5]decan-10-one.
| Compound Name | 9-benzyl-1-(4-fluoro-3-methylbenzoyl)-1,9-diazaspiro[4.5]decan-10-one |
|---|---|
| PubChem CID | 162625491 |
| Molecular Formula | C23H25FN2O2 |
| Molecular Weight | 380.46 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | 9-benzyl-1-(4-fluoro-3-methylbenzoyl)-1,9-diazaspiro[4.5]decan-10-one |
| SMILES | Cc1cc(C(=O)N2CCCC23CCCN(Cc2ccccc2)C3=O)ccc1F |
| InChI | InChI=1S/C23H25FN2O2/c1-17-15-19(9-10-20(17)24)21(27)26-14-6-12-23(26)11-5-13-25(22(23)28)16-18-7-3-2-4-8-18/h2-4,7-10,15H,5-6,11-14,16H2,1H3 |
| InChIKey | ILERMJPUSJSYRL-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.46 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |