C19H31N5O — CID 157015836
4-[(1R,2S,5S)-3,7-diazabicyclo[3.3.1]nonan-2-yl]-N-[2-[(3-methyl-2-pyridinyl)amino]ethyl]butanamide (PubChem CID 157015836) has the molecular formula C19H31N5O and a molecular weight of 345.49 g/mol. Its IUPAC name is 4-[(1R,2S,5S)-3,7-diazabicyclo[3.3.1]nonan-2-yl]-N-[2-[(3-methyl-2-pyridinyl)amino]ethyl]butanamide.
| Compound Name | 4-[(1R,2S,5S)-3,7-diazabicyclo[3.3.1]nonan-2-yl]-N-[2-[(3-methyl-2-pyridinyl)amino]ethyl]butanamide |
|---|---|
| PubChem CID | 157015836 |
| Molecular Formula | C19H31N5O |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.25 |
| IUPAC Name | 4-[(1R,2S,5S)-3,7-diazabicyclo[3.3.1]nonan-2-yl]-N-[2-[(3-methyl-2-pyridinyl)amino]ethyl]butanamide |
| SMILES | Cc1cccnc1NCCNC(=O)CCC[C@@H]1NC[C@@H]2CNC[C@H]1C2 |
| InChI | InChI=1S/C19H31N5O/c1-14-4-3-7-22-19(14)23-9-8-21-18(25)6-2-5-17-16-10-15(12-24-17)11-20-13-16/h3-4,7,15-17,20,24H,2,5-6,8-13H2,1H3,(H,21,25)(H,22,23)/t15-,16+,17-/m0/s1 |
| InChIKey | WBHGBMLDCSGPGT-BBWFWOEESA-N |
| XLogP | 1.29 |
| TPSA | 78.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|