C12H13N5S — CID 157016716
2-[[4-(dimethylamino)-5-methylpyrimidin-2-yl]amino]thiophene-3-carbonitrile (PubChem CID 157016716) has the molecular formula C12H13N5S and a molecular weight of 259.34 g/mol. Its IUPAC name is 2-[[4-(dimethylamino)-5-methylpyrimidin-2-yl]amino]thiophene-3-carbonitrile.
| Compound Name | 2-[[4-(dimethylamino)-5-methylpyrimidin-2-yl]amino]thiophene-3-carbonitrile |
|---|---|
| PubChem CID | 157016716 |
| Molecular Formula | C12H13N5S |
| Molecular Weight | 259.34 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 2-[[4-(dimethylamino)-5-methylpyrimidin-2-yl]amino]thiophene-3-carbonitrile |
| SMILES | Cc1cnc(Nc2sccc2C#N)nc1N(C)C |
| InChI | InChI=1S/C12H13N5S/c1-8-7-14-12(15-10(8)17(2)3)16-11-9(6-13)4-5-18-11/h4-5,7H,1-3H3,(H,14,15,16) |
| InChIKey | WWKBEIRIQOGBAP-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 64.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.34 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |