C19H29ClN2O2 — CID 157017128
1-[(5-chloro-3-methoxy-2-propoxyphenyl)methyl]-4-cyclopropyl-2-methylpiperazine (PubChem CID 157017128) has the molecular formula C19H29ClN2O2 and a molecular weight of 352.91 g/mol. Its IUPAC name is 1-[(5-chloro-3-methoxy-2-propoxyphenyl)methyl]-4-cyclopropyl-2-methylpiperazine.
| Compound Name | 1-[(5-chloro-3-methoxy-2-propoxyphenyl)methyl]-4-cyclopropyl-2-methylpiperazine |
|---|---|
| PubChem CID | 157017128 |
| Molecular Formula | C19H29ClN2O2 |
| Molecular Weight | 352.91 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | 1-[(5-chloro-3-methoxy-2-propoxyphenyl)methyl]-4-cyclopropyl-2-methylpiperazine |
| SMILES | CCCOc1c(CN2CCN(C3CC3)CC2C)cc(Cl)cc1OC |
| InChI | InChI=1S/C19H29ClN2O2/c1-4-9-24-19-15(10-16(20)11-18(19)23-3)13-21-7-8-22(12-14(21)2)17-5-6-17/h10-11,14,17H,4-9,12-13H2,1-3H3 |
| InChIKey | YJIRXYKHMZEBAC-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.91 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |