C21H34N2O — CID 157019220
4-cyclopropyl-1-[(4-ethoxy-2-methyl-5-propan-2-ylphenyl)methyl]-2-methylpiperazine (PubChem CID 157019220) has the molecular formula C21H34N2O and a molecular weight of 330.52 g/mol. Its IUPAC name is 4-cyclopropyl-1-[(4-ethoxy-2-methyl-5-propan-2-ylphenyl)methyl]-2-methylpiperazine.
| Compound Name | 4-cyclopropyl-1-[(4-ethoxy-2-methyl-5-propan-2-ylphenyl)methyl]-2-methylpiperazine |
|---|---|
| PubChem CID | 157019220 |
| Molecular Formula | C21H34N2O |
| Molecular Weight | 330.52 g/mol |
| Exact Mass | 330.27 |
| IUPAC Name | 4-cyclopropyl-1-[(4-ethoxy-2-methyl-5-propan-2-ylphenyl)methyl]-2-methylpiperazine |
| SMILES | CCOc1cc(C)c(CN2CCN(C3CC3)CC2C)cc1C(C)C |
| InChI | InChI=1S/C21H34N2O/c1-6-24-21-11-16(4)18(12-20(21)15(2)3)14-22-9-10-23(13-17(22)5)19-7-8-19/h11-12,15,17,19H,6-10,13-14H2,1-5H3 |
| InChIKey | UIIBQGSYNQBISH-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.52 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |