C20H31NO3 — CID 74243559
2-[1-[(4-ethoxy-2-methyl-5-propan-2-ylphenyl)methyl]piperidin-2-yl]acetic acid (PubChem CID 74243559) has the molecular formula C20H31NO3 and a molecular weight of 333.47 g/mol. Its IUPAC name is 2-[1-[(4-ethoxy-2-methyl-5-propan-2-ylphenyl)methyl]piperidin-2-yl]acetic acid.
| Compound Name | 2-[1-[(4-ethoxy-2-methyl-5-propan-2-ylphenyl)methyl]piperidin-2-yl]acetic acid |
|---|---|
| PubChem CID | 74243559 |
| Molecular Formula | C20H31NO3 |
| Molecular Weight | 333.47 g/mol |
| Exact Mass | 333.23 |
| IUPAC Name | 2-[1-[(4-ethoxy-2-methyl-5-propan-2-ylphenyl)methyl]piperidin-2-yl]acetic acid |
| SMILES | CCOc1cc(C)c(CN2CCCCC2CC(=O)O)cc1C(C)C |
| InChI | InChI=1S/C20H31NO3/c1-5-24-19-10-15(4)16(11-18(19)14(2)3)13-21-9-7-6-8-17(21)12-20(22)23/h10-11,14,17H,5-9,12-13H2,1-4H3,(H,22,23) |
| InChIKey | ZUFZQIHPMPGWJC-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.47 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |