C17H19N7O2 — CID 157017306
(5-methyl-3-phenyl-1H-pyrazol-4-yl)-[2-(1-methyltetrazol-5-yl)morpholin-4-yl]methanone (PubChem CID 157017306) has the molecular formula C17H19N7O2 and a molecular weight of 353.39 g/mol. Its IUPAC name is (5-methyl-3-phenyl-1H-pyrazol-4-yl)-[2-(1-methyltetrazol-5-yl)morpholin-4-yl]methanone.
| Compound Name | (5-methyl-3-phenyl-1H-pyrazol-4-yl)-[2-(1-methyltetrazol-5-yl)morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 157017306 |
| Molecular Formula | C17H19N7O2 |
| Molecular Weight | 353.39 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | (5-methyl-3-phenyl-1H-pyrazol-4-yl)-[2-(1-methyltetrazol-5-yl)morpholin-4-yl]methanone |
| SMILES | Cc1[nH]nc(-c2ccccc2)c1C(=O)N1CCOC(c2nnnn2C)C1 |
| InChI | InChI=1S/C17H19N7O2/c1-11-14(15(19-18-11)12-6-4-3-5-7-12)17(25)24-8-9-26-13(10-24)16-20-21-22-23(16)2/h3-7,13H,8-10H2,1-2H3,(H,18,19) |
| InChIKey | KUVXBPQPZIAYLS-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.39 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |