C16H17N7O3 — CID 165420118
2-methyl-4-[2-(1-methyltetrazol-5-yl)morpholine-4-carbonyl]phthalazin-1-one (PubChem CID 165420118) has the molecular formula C16H17N7O3 and a molecular weight of 355.36 g/mol. Its IUPAC name is 2-methyl-4-[2-(1-methyltetrazol-5-yl)morpholine-4-carbonyl]phthalazin-1-one.
| Compound Name | 2-methyl-4-[2-(1-methyltetrazol-5-yl)morpholine-4-carbonyl]phthalazin-1-one |
|---|---|
| PubChem CID | 165420118 |
| Molecular Formula | C16H17N7O3 |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 2-methyl-4-[2-(1-methyltetrazol-5-yl)morpholine-4-carbonyl]phthalazin-1-one |
| SMILES | Cn1nnnc1C1CN(C(=O)c2nn(C)c(=O)c3ccccc23)CCO1 |
| InChI | InChI=1S/C16H17N7O3/c1-21-14(17-19-20-21)12-9-23(7-8-26-12)16(25)13-10-5-3-4-6-11(10)15(24)22(2)18-13/h3-6,12H,7-9H2,1-2H3 |
| InChIKey | GZNFFBCZZPFTOZ-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 108.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |