C19H24N6O4 — CID 157020094
N-[(1R,2R,5S)-2-hydroxy-5-(3-oxo-1,4-diazepane-1-carbonyl)cyclohexyl]-[1,2,4]triazolo[1,5-a]pyridine-6-carboxamide (PubChem CID 157020094) has the molecular formula C19H24N6O4 and a molecular weight of 400.44 g/mol. Its IUPAC name is N-[(1R,2R,5S)-2-hydroxy-5-(3-oxo-1,4-diazepane-1-carbonyl)cyclohexyl]-[1,2,4]triazolo[1,5-a]pyridine-6-carboxamide.
| Compound Name | N-[(1R,2R,5S)-2-hydroxy-5-(3-oxo-1,4-diazepane-1-carbonyl)cyclohexyl]-[1,2,4]triazolo[1,5-a]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 157020094 |
| Molecular Formula | C19H24N6O4 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | N-[(1R,2R,5S)-2-hydroxy-5-(3-oxo-1,4-diazepane-1-carbonyl)cyclohexyl]-[1,2,4]triazolo[1,5-a]pyridine-6-carboxamide |
| SMILES | O=C1CN(C(=O)[C@H]2CC[C@@H](O)[C@H](NC(=O)c3ccc4ncnn4c3)C2)CCCN1 |
| InChI | InChI=1S/C19H24N6O4/c26-15-4-2-12(19(29)24-7-1-6-20-17(27)10-24)8-14(15)23-18(28)13-3-5-16-21-11-22-25(16)9-13/h3,5,9,11-12,14-15,26H,1-2,4,6-8,10H2,(H,20,27)(H,23,28)/t12-,14+,15+/m0/s1 |
| InChIKey | NKQGCODJVWWSDF-NWANDNLSSA-N |
| XLogP | -0.66 |
| TPSA | 128.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |