C29H37FN6O6 — CID 157021449
tert-butyl (1S,2R,3R,5R)-3-[[6-[2-(dimethylcarbamoyl)-5-(methoxymethoxy)-1-benzofuran-6-yl]-1,2,4-triazin-3-yl]-methylamino]-2-fluoro-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 157021449) has the molecular formula C29H37FN6O6 and a molecular weight of 584.65 g/mol. Its IUPAC name is tert-butyl (1S,2R,3R,5R)-3-[[6-[2-(dimethylcarbamoyl)-5-(methoxymethoxy)-1-benzofuran-6-yl]-1,2,4-triazin-3-yl]-methylamino]-2-fluoro-8-azabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | tert-butyl (1S,2R,3R,5R)-3-[[6-[2-(dimethylcarbamoyl)-5-(methoxymethoxy)-1-benzofuran-6-yl]-1,2,4-triazin-3-yl]-methylamino]-2-fluoro-8-azabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 157021449 |
| Molecular Formula | C29H37FN6O6 |
| Molecular Weight | 584.65 g/mol |
| Exact Mass | 584.28 |
| IUPAC Name | tert-butyl (1S,2R,3R,5R)-3-[[6-[2-(dimethylcarbamoyl)-5-(methoxymethoxy)-1-benzofuran-6-yl]-1,2,4-triazin-3-yl]-methylamino]-2-fluoro-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | COCOc1cc2cc(C(=O)N(C)C)oc2cc1-c1cnc(N(C)[C@@H]2C[C@H]3CC[C@@H]([C@@H]2F)N3C(=O)OC(C)(C)C)nn1 |
| InChI | InChI=1S/C29H37FN6O6/c1-29(2,3)42-28(38)36-17-8-9-20(36)25(30)21(12-17)35(6)27-31-14-19(32-33-27)18-13-22-16(10-23(18)40-15-39-7)11-24(41-22)26(37)34(4)5/h10-11,13-14,17,20-21,25H,8-9,12,15H2,1-7H3/t17-,20+,21-,25+/m1/s1 |
| InChIKey | KLXHLVJIPVEFCP-XCAMGBOJSA-N |
| XLogP | 4.28 |
| TPSA | 123.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.65 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|