C22H25FN6O3 — CID 157021467
6-[3-[[(1R,2R,3S,5S)-2-fluoro-8-azabicyclo[3.2.1]octan-3-yl]-methylamino]-1,2,4-triazin-6-yl]-5-hydroxy-N,N-dimethyl-1-benzofuran-2-carboxamide (PubChem CID 157021467) has the molecular formula C22H25FN6O3 and a molecular weight of 440.48 g/mol. Its IUPAC name is 6-[3-[[(1R,2R,3S,5S)-2-fluoro-8-azabicyclo[3.2.1]octan-3-yl]-methylamino]-1,2,4-triazin-6-yl]-5-hydroxy-N,N-dimethyl-1-benzofuran-2-carboxamide.
| Compound Name | 6-[3-[[(1R,2R,3S,5S)-2-fluoro-8-azabicyclo[3.2.1]octan-3-yl]-methylamino]-1,2,4-triazin-6-yl]-5-hydroxy-N,N-dimethyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 157021467 |
| Molecular Formula | C22H25FN6O3 |
| Molecular Weight | 440.48 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | 6-[3-[[(1R,2R,3S,5S)-2-fluoro-8-azabicyclo[3.2.1]octan-3-yl]-methylamino]-1,2,4-triazin-6-yl]-5-hydroxy-N,N-dimethyl-1-benzofuran-2-carboxamide |
| SMILES | CN(C)C(=O)c1cc2cc(O)c(-c3cnc(N(C)[C@H]4C[C@@H]5CC[C@@H](N5)[C@H]4F)nn3)cc2o1 |
| InChI | InChI=1S/C22H25FN6O3/c1-28(2)21(31)19-7-11-6-17(30)13(9-18(11)32-19)15-10-24-22(27-26-15)29(3)16-8-12-4-5-14(25-12)20(16)23/h6-7,9-10,12,14,16,20,25,30H,4-5,8H2,1-3H3/t12-,14+,16-,20+/m0/s1 |
| InChIKey | ZBIUZXUFPPXPAL-MXLMCZCFSA-N |
| XLogP | 2.36 |
| TPSA | 107.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.48 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |