C26H26FN5O3 — CID 167319318
2-[3-[cyclopropyl-[(1S,2S,3R,5S)-2-fluoro-8-azabicyclo[3.2.1]octan-3-yl]amino]-1,2,4-triazin-6-yl]-5-(2,2-dideuterio-1,3-benzodioxol-5-yl)phenol (PubChem CID 167319318) has the molecular formula C26H26FN5O3 and a molecular weight of 477.54 g/mol. Its IUPAC name is 2-[3-[cyclopropyl-[(1S,2S,3R,5S)-2-fluoro-8-azabicyclo[3.2.1]octan-3-yl]amino]-1,2,4-triazin-6-yl]-5-(2,2-dideuterio-1,3-benzodioxol-5-yl)phenol.
| Compound Name | 2-[3-[cyclopropyl-[(1S,2S,3R,5S)-2-fluoro-8-azabicyclo[3.2.1]octan-3-yl]amino]-1,2,4-triazin-6-yl]-5-(2,2-dideuterio-1,3-benzodioxol-5-yl)phenol |
|---|---|
| PubChem CID | 167319318 |
| Molecular Formula | C26H26FN5O3 |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | 2-[3-[cyclopropyl-[(1S,2S,3R,5S)-2-fluoro-8-azabicyclo[3.2.1]octan-3-yl]amino]-1,2,4-triazin-6-yl]-5-(2,2-dideuterio-1,3-benzodioxol-5-yl)phenol |
| SMILES | [2H]C1([2H])Oc2ccc(-c3ccc(-c4cnc(N(C5CC5)[C@@H]5C[C@@H]6CC[C@H](N6)[C@@H]5F)nn4)c(O)c3)cc2O1 |
| InChI | InChI=1S/C26H26FN5O3/c27-25-19-7-3-16(29-19)11-21(25)32(17-4-5-17)26-28-12-20(30-31-26)18-6-1-14(9-22(18)33)15-2-8-23-24(10-15)35-13-34-23/h1-2,6,8-10,12,16-17,19,21,25,29,33H,3-5,7,11,13H2/t16-,19-,21+,25-/m0/s1/i13D2 |
| InChIKey | PIJNPKQEEVZXJU-QVYGCSIJSA-N |
| XLogP | 3.84 |
| TPSA | 92.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |