C24H24FN7OS — CID 167319094
5-[4-[3-[cyclopropyl-[(1S,2S,3R,5S)-2-fluoro-9-azabicyclo[3.3.1]nonan-3-yl]amino]-1,2,4-triazin-6-yl]-3-hydroxyphenyl]-1,3-thiazole-2-carbonitrile (PubChem CID 167319094) has the molecular formula C24H24FN7OS and a molecular weight of 477.57 g/mol. Its IUPAC name is 5-[4-[3-[cyclopropyl-[(1S,2S,3R,5S)-2-fluoro-9-azabicyclo[3.3.1]nonan-3-yl]amino]-1,2,4-triazin-6-yl]-3-hydroxyphenyl]-1,3-thiazole-2-carbonitrile.
| Compound Name | 5-[4-[3-[cyclopropyl-[(1S,2S,3R,5S)-2-fluoro-9-azabicyclo[3.3.1]nonan-3-yl]amino]-1,2,4-triazin-6-yl]-3-hydroxyphenyl]-1,3-thiazole-2-carbonitrile |
|---|---|
| PubChem CID | 167319094 |
| Molecular Formula | C24H24FN7OS |
| Molecular Weight | 477.57 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | 5-[4-[3-[cyclopropyl-[(1S,2S,3R,5S)-2-fluoro-9-azabicyclo[3.3.1]nonan-3-yl]amino]-1,2,4-triazin-6-yl]-3-hydroxyphenyl]-1,3-thiazole-2-carbonitrile |
| SMILES | N#Cc1ncc(-c2ccc(-c3cnc(N(C4CC4)[C@@H]4C[C@@H]5CCC[C@H](N5)[C@@H]4F)nn3)c(O)c2)s1 |
| InChI | InChI=1S/C24H24FN7OS/c25-23-17-3-1-2-14(29-17)9-19(23)32(15-5-6-15)24-28-11-18(30-31-24)16-7-4-13(8-20(16)33)21-12-27-22(10-26)34-21/h4,7-8,11-12,14-15,17,19,23,29,33H,1-3,5-6,9H2/t14-,17-,19+,23-/m0/s1 |
| InChIKey | BPSDOHSHRRXNJL-UJOKMUSASA-N |
| XLogP | 3.83 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.57 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |