C22H21FN8OS — CID 166581075
5-[4-[6-[cyclopropyl-[(1R,2S,3R,5S)-2-fluoro-8-azabicyclo[3.2.1]octan-3-yl]amino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1,3,4-thiadiazole-2-carbonitrile (PubChem CID 166581075) has the molecular formula C22H21FN8OS and a molecular weight of 464.53 g/mol. Its IUPAC name is 5-[4-[6-[cyclopropyl-[(1R,2S,3R,5S)-2-fluoro-8-azabicyclo[3.2.1]octan-3-yl]amino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1,3,4-thiadiazole-2-carbonitrile.
| Compound Name | 5-[4-[6-[cyclopropyl-[(1R,2S,3R,5S)-2-fluoro-8-azabicyclo[3.2.1]octan-3-yl]amino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1,3,4-thiadiazole-2-carbonitrile |
|---|---|
| PubChem CID | 166581075 |
| Molecular Formula | C22H21FN8OS |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | 5-[4-[6-[cyclopropyl-[(1R,2S,3R,5S)-2-fluoro-8-azabicyclo[3.2.1]octan-3-yl]amino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1,3,4-thiadiazole-2-carbonitrile |
| SMILES | N#Cc1nnc(-c2ccc(-c3ncc(N(C4CC4)[C@@H]4C[C@@H]5CC[C@@H](N5)[C@@H]4F)nn3)c(O)c2)s1 |
| InChI | InChI=1S/C22H21FN8OS/c23-20-15-6-2-12(26-15)8-16(20)31(13-3-4-13)18-10-25-21(29-27-18)14-5-1-11(7-17(14)32)22-30-28-19(9-24)33-22/h1,5,7,10,12-13,15-16,20,26,32H,2-4,6,8H2/t12-,15+,16+,20-/m0/s1 |
| InChIKey | DMRYZMIUNBHFGS-WJBZZZKMSA-N |
| XLogP | 2.83 |
| TPSA | 123.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |