C20H19FN8OS — CID 166580146
5-[4-[6-[[(1S,2R,3S,5R)-2-fluoro-8-azabicyclo[3.2.1]octan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1,3,4-thiadiazole-2-carbonitrile (PubChem CID 166580146) has the molecular formula C20H19FN8OS and a molecular weight of 438.49 g/mol. Its IUPAC name is 5-[4-[6-[[(1S,2R,3S,5R)-2-fluoro-8-azabicyclo[3.2.1]octan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1,3,4-thiadiazole-2-carbonitrile.
| Compound Name | 5-[4-[6-[[(1S,2R,3S,5R)-2-fluoro-8-azabicyclo[3.2.1]octan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1,3,4-thiadiazole-2-carbonitrile |
|---|---|
| PubChem CID | 166580146 |
| Molecular Formula | C20H19FN8OS |
| Molecular Weight | 438.49 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | 5-[4-[6-[[(1S,2R,3S,5R)-2-fluoro-8-azabicyclo[3.2.1]octan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1,3,4-thiadiazole-2-carbonitrile |
| SMILES | CN(c1cnc(-c2ccc(-c3nnc(C#N)s3)cc2O)nn1)[C@H]1C[C@H]2CC[C@H](N2)[C@H]1F |
| InChI | InChI=1S/C20H19FN8OS/c1-29(14-7-11-3-5-13(24-11)18(14)21)16-9-23-19(27-25-16)12-4-2-10(6-15(12)30)20-28-26-17(8-22)31-20/h2,4,6,9,11,13-14,18,24,30H,3,5,7H2,1H3/t11-,13+,14+,18-/m1/s1 |
| InChIKey | ZDZBSTHEOQEINW-ZLJVHPLZSA-N |
| XLogP | 2.30 |
| TPSA | 123.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.49 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |