C24H25FN8OS — CID 166580754
5-[4-[6-[cyclopropyl-[(1R,3R,4S,5R)-4-fluoro-1-methyl-9-azabicyclo[3.3.1]nonan-3-yl]amino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1,3,4-thiadiazole-2-carbonitrile (PubChem CID 166580754) has the molecular formula C24H25FN8OS and a molecular weight of 492.58 g/mol. Its IUPAC name is 5-[4-[6-[cyclopropyl-[(1R,3R,4S,5R)-4-fluoro-1-methyl-9-azabicyclo[3.3.1]nonan-3-yl]amino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1,3,4-thiadiazole-2-carbonitrile.
| Compound Name | 5-[4-[6-[cyclopropyl-[(1R,3R,4S,5R)-4-fluoro-1-methyl-9-azabicyclo[3.3.1]nonan-3-yl]amino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1,3,4-thiadiazole-2-carbonitrile |
|---|---|
| PubChem CID | 166580754 |
| Molecular Formula | C24H25FN8OS |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | 5-[4-[6-[cyclopropyl-[(1R,3R,4S,5R)-4-fluoro-1-methyl-9-azabicyclo[3.3.1]nonan-3-yl]amino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1,3,4-thiadiazole-2-carbonitrile |
| SMILES | C[C@]12CCC[C@@H](N1)[C@H](F)[C@H](N(c1cnc(-c3ccc(-c4nnc(C#N)s4)cc3O)nn1)C1CC1)C2 |
| InChI | InChI=1S/C24H25FN8OS/c1-24-8-2-3-16(28-24)21(25)17(10-24)33(14-5-6-14)19-12-27-22(31-29-19)15-7-4-13(9-18(15)34)23-32-30-20(11-26)35-23/h4,7,9,12,14,16-17,21,28,34H,2-3,5-6,8,10H2,1H3/t16-,17-,21+,24-/m1/s1 |
| InChIKey | XKKHRIPFARVTRW-VPPNUOKLSA-N |
| XLogP | 3.61 |
| TPSA | 123.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |