C24H27N7OS — CID 167306352
5-[4-[6-[[(1S,5R)-1,5-dimethyl-9-azabicyclo[3.3.1]nonan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1,3-thiazole-2-carbonitrile (PubChem CID 167306352) has the molecular formula C24H27N7OS and a molecular weight of 461.60 g/mol. Its IUPAC name is 5-[4-[6-[[(1S,5R)-1,5-dimethyl-9-azabicyclo[3.3.1]nonan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1,3-thiazole-2-carbonitrile.
| Compound Name | 5-[4-[6-[[(1S,5R)-1,5-dimethyl-9-azabicyclo[3.3.1]nonan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1,3-thiazole-2-carbonitrile |
|---|---|
| PubChem CID | 167306352 |
| Molecular Formula | C24H27N7OS |
| Molecular Weight | 461.60 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | 5-[4-[6-[[(1S,5R)-1,5-dimethyl-9-azabicyclo[3.3.1]nonan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1,3-thiazole-2-carbonitrile |
| SMILES | CN(c1cnc(-c2ccc(-c3cnc(C#N)s3)cc2O)nn1)C1C[C@]2(C)CCC[C@](C)(C1)N2 |
| InChI | InChI=1S/C24H27N7OS/c1-23-7-4-8-24(2,30-23)11-16(10-23)31(3)20-14-27-22(29-28-20)17-6-5-15(9-18(17)32)19-13-26-21(12-25)33-19/h5-6,9,13-14,16,30,32H,4,7-8,10-11H2,1-3H3/t16?,23-,24+ |
| InChIKey | NGWCMRBERPCHGU-OOAWLCDSSA-N |
| XLogP | 4.13 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.60 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |