C29H36N6O3 — CID 167302178
2-[6-[cyclopropyl-[(1S,5R)-1,5-dimethyl-9-azabicyclo[3.3.1]nonan-3-yl]amino]-1,2,4-triazin-3-yl]-5-(5,6-dimethoxy-3-pyridinyl)phenol (PubChem CID 167302178) has the molecular formula C29H36N6O3 and a molecular weight of 516.65 g/mol. Its IUPAC name is 2-[6-[cyclopropyl-[(1S,5R)-1,5-dimethyl-9-azabicyclo[3.3.1]nonan-3-yl]amino]-1,2,4-triazin-3-yl]-5-(5,6-dimethoxy-3-pyridinyl)phenol.
| Compound Name | 2-[6-[cyclopropyl-[(1S,5R)-1,5-dimethyl-9-azabicyclo[3.3.1]nonan-3-yl]amino]-1,2,4-triazin-3-yl]-5-(5,6-dimethoxy-3-pyridinyl)phenol |
|---|---|
| PubChem CID | 167302178 |
| Molecular Formula | C29H36N6O3 |
| Molecular Weight | 516.65 g/mol |
| Exact Mass | 516.28 |
| IUPAC Name | 2-[6-[cyclopropyl-[(1S,5R)-1,5-dimethyl-9-azabicyclo[3.3.1]nonan-3-yl]amino]-1,2,4-triazin-3-yl]-5-(5,6-dimethoxy-3-pyridinyl)phenol |
| SMILES | COc1cc(-c2ccc(-c3ncc(N(C4CC4)C4C[C@]5(C)CCC[C@](C)(C4)N5)nn3)c(O)c2)cnc1OC |
| InChI | InChI=1S/C29H36N6O3/c1-28-10-5-11-29(2,34-28)15-21(14-28)35(20-7-8-20)25-17-30-26(33-32-25)22-9-6-18(12-23(22)36)19-13-24(37-3)27(38-4)31-16-19/h6,9,12-13,16-17,20-21,34,36H,5,7-8,10-11,14-15H2,1-4H3/t21?,28-,29+ |
| InChIKey | GQZJSJZWTPJTKC-SBCITRRXSA-N |
| XLogP | 4.75 |
| TPSA | 105.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.65 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |