C28H35N7O3 — CID 167302026
2-[6-[cyclopropyl-[(1S,5R)-1,5-dimethyl-9-azabicyclo[3.3.1]nonan-3-yl]amino]-1,2,4-triazin-3-yl]-5-(5,6-dimethoxypyrazin-2-yl)phenol (PubChem CID 167302026) has the molecular formula C28H35N7O3 and a molecular weight of 517.63 g/mol. Its IUPAC name is 2-[6-[cyclopropyl-[(1S,5R)-1,5-dimethyl-9-azabicyclo[3.3.1]nonan-3-yl]amino]-1,2,4-triazin-3-yl]-5-(5,6-dimethoxypyrazin-2-yl)phenol.
| Compound Name | 2-[6-[cyclopropyl-[(1S,5R)-1,5-dimethyl-9-azabicyclo[3.3.1]nonan-3-yl]amino]-1,2,4-triazin-3-yl]-5-(5,6-dimethoxypyrazin-2-yl)phenol |
|---|---|
| PubChem CID | 167302026 |
| Molecular Formula | C28H35N7O3 |
| Molecular Weight | 517.63 g/mol |
| Exact Mass | 517.28 |
| IUPAC Name | 2-[6-[cyclopropyl-[(1S,5R)-1,5-dimethyl-9-azabicyclo[3.3.1]nonan-3-yl]amino]-1,2,4-triazin-3-yl]-5-(5,6-dimethoxypyrazin-2-yl)phenol |
| SMILES | COc1ncc(-c2ccc(-c3ncc(N(C4CC4)C4C[C@]5(C)CCC[C@](C)(C4)N5)nn3)c(O)c2)nc1OC |
| InChI | InChI=1S/C28H35N7O3/c1-27-10-5-11-28(2,34-27)14-19(13-27)35(18-7-8-18)23-16-29-24(33-32-23)20-9-6-17(12-22(20)36)21-15-30-25(37-3)26(31-21)38-4/h6,9,12,15-16,18-19,34,36H,5,7-8,10-11,13-14H2,1-4H3/t19?,27-,28+ |
| InChIKey | LGOBZMKJMRGGNR-LROIZVCLSA-N |
| XLogP | 4.14 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.63 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |