C25H30FN7O3 — CID 166580429
5-(5,6-dimethoxypyrazin-2-yl)-2-[6-[[(1S,2R,3R,5R)-2-fluoro-1,5-dimethyl-8-azabicyclo[3.2.1]octan-3-yl]-methylamino]-1,2,4-triazin-3-yl]phenol (PubChem CID 166580429) has the molecular formula C25H30FN7O3 and a molecular weight of 495.56 g/mol. Its IUPAC name is 5-(5,6-dimethoxypyrazin-2-yl)-2-[6-[[(1S,2R,3R,5R)-2-fluoro-1,5-dimethyl-8-azabicyclo[3.2.1]octan-3-yl]-methylamino]-1,2,4-triazin-3-yl]phenol.
| Compound Name | 5-(5,6-dimethoxypyrazin-2-yl)-2-[6-[[(1S,2R,3R,5R)-2-fluoro-1,5-dimethyl-8-azabicyclo[3.2.1]octan-3-yl]-methylamino]-1,2,4-triazin-3-yl]phenol |
|---|---|
| PubChem CID | 166580429 |
| Molecular Formula | C25H30FN7O3 |
| Molecular Weight | 495.56 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | 5-(5,6-dimethoxypyrazin-2-yl)-2-[6-[[(1S,2R,3R,5R)-2-fluoro-1,5-dimethyl-8-azabicyclo[3.2.1]octan-3-yl]-methylamino]-1,2,4-triazin-3-yl]phenol |
| SMILES | COc1ncc(-c2ccc(-c3ncc(N(C)[C@@H]4C[C@@]5(C)CC[C@](C)(N5)[C@@H]4F)nn3)c(O)c2)nc1OC |
| InChI | InChI=1S/C25H30FN7O3/c1-24-8-9-25(2,32-24)20(26)17(11-24)33(3)19-13-27-21(31-30-19)15-7-6-14(10-18(15)34)16-12-28-22(35-4)23(29-16)36-5/h6-7,10,12-13,17,20,32,34H,8-9,11H2,1-5H3/t17-,20-,24-,25+/m1/s1 |
| InChIKey | JNDYGVBSEGWMFL-DWEPYNOVSA-N |
| XLogP | 3.17 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.56 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |