C25H28F2N6OS — CID 166580249
2-[6-[[(1S,2R,3R,5R)-2-fluoro-1,5-dimethyl-8-azabicyclo[3.2.1]octan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-5-(2-fluoro-6-methylsulfanyl-4-pyridinyl)phenol (PubChem CID 166580249) has the molecular formula C25H28F2N6OS and a molecular weight of 498.60 g/mol. Its IUPAC name is 2-[6-[[(1S,2R,3R,5R)-2-fluoro-1,5-dimethyl-8-azabicyclo[3.2.1]octan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-5-(2-fluoro-6-methylsulfanyl-4-pyridinyl)phenol.
| Compound Name | 2-[6-[[(1S,2R,3R,5R)-2-fluoro-1,5-dimethyl-8-azabicyclo[3.2.1]octan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-5-(2-fluoro-6-methylsulfanyl-4-pyridinyl)phenol |
|---|---|
| PubChem CID | 166580249 |
| Molecular Formula | C25H28F2N6OS |
| Molecular Weight | 498.60 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | 2-[6-[[(1S,2R,3R,5R)-2-fluoro-1,5-dimethyl-8-azabicyclo[3.2.1]octan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-5-(2-fluoro-6-methylsulfanyl-4-pyridinyl)phenol |
| SMILES | CSc1cc(-c2ccc(-c3ncc(N(C)[C@@H]4C[C@@]5(C)CC[C@](C)(N5)[C@@H]4F)nn3)c(O)c2)cc(F)n1 |
| InChI | InChI=1S/C25H28F2N6OS/c1-24-7-8-25(2,32-24)22(27)17(12-24)33(3)20-13-28-23(31-30-20)16-6-5-14(9-18(16)34)15-10-19(26)29-21(11-15)35-4/h5-6,9-11,13,17,22,32,34H,7-8,12H2,1-4H3/t17-,22-,24-,25+/m1/s1 |
| InChIKey | CLRSZYINBIDZIY-XTUVKROYSA-N |
| XLogP | 4.61 |
| TPSA | 87.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.60 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|