C24H27F2N7OS — CID 166580355
2-[6-[[(1S,2R,3R,5R)-2-fluoro-1,5-dimethyl-8-azabicyclo[3.2.1]octan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-5-(5-fluoro-2-methylsulfanylpyrimidin-4-yl)phenol (PubChem CID 166580355) has the molecular formula C24H27F2N7OS and a molecular weight of 499.59 g/mol. Its IUPAC name is 2-[6-[[(1S,2R,3R,5R)-2-fluoro-1,5-dimethyl-8-azabicyclo[3.2.1]octan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-5-(5-fluoro-2-methylsulfanylpyrimidin-4-yl)phenol.
| Compound Name | 2-[6-[[(1S,2R,3R,5R)-2-fluoro-1,5-dimethyl-8-azabicyclo[3.2.1]octan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-5-(5-fluoro-2-methylsulfanylpyrimidin-4-yl)phenol |
|---|---|
| PubChem CID | 166580355 |
| Molecular Formula | C24H27F2N7OS |
| Molecular Weight | 499.59 g/mol |
| Exact Mass | 499.20 |
| IUPAC Name | 2-[6-[[(1S,2R,3R,5R)-2-fluoro-1,5-dimethyl-8-azabicyclo[3.2.1]octan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-5-(5-fluoro-2-methylsulfanylpyrimidin-4-yl)phenol |
| SMILES | CSc1ncc(F)c(-c2ccc(-c3ncc(N(C)[C@@H]4C[C@@]5(C)CC[C@](C)(N5)[C@@H]4F)nn3)c(O)c2)n1 |
| InChI | InChI=1S/C24H27F2N7OS/c1-23-7-8-24(2,32-23)20(26)16(10-23)33(3)18-12-27-21(31-30-18)14-6-5-13(9-17(14)34)19-15(25)11-28-22(29-19)35-4/h5-6,9,11-12,16,20,32,34H,7-8,10H2,1-4H3/t16-,20-,23-,24+/m1/s1 |
| InChIKey | BXDRJLNBYOSMAH-RWJCITIMSA-N |
| XLogP | 4.01 |
| TPSA | 99.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.59 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |