C23H24FN7OS — CID 166580480
2-[4-[6-[[(1R,2S,3S,5S)-2-fluoro-1,5-dimethyl-8-azabicyclo[3.2.1]octan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1,3-thiazole-5-carbonitrile (PubChem CID 166580480) has the molecular formula C23H24FN7OS and a molecular weight of 465.56 g/mol. Its IUPAC name is 2-[4-[6-[[(1R,2S,3S,5S)-2-fluoro-1,5-dimethyl-8-azabicyclo[3.2.1]octan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1,3-thiazole-5-carbonitrile.
| Compound Name | 2-[4-[6-[[(1R,2S,3S,5S)-2-fluoro-1,5-dimethyl-8-azabicyclo[3.2.1]octan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1,3-thiazole-5-carbonitrile |
|---|---|
| PubChem CID | 166580480 |
| Molecular Formula | C23H24FN7OS |
| Molecular Weight | 465.56 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | 2-[4-[6-[[(1R,2S,3S,5S)-2-fluoro-1,5-dimethyl-8-azabicyclo[3.2.1]octan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1,3-thiazole-5-carbonitrile |
| SMILES | CN(c1cnc(-c2ccc(-c3ncc(C#N)s3)cc2O)nn1)[C@H]1C[C@]2(C)CC[C@@](C)(N2)[C@H]1F |
| InChI | InChI=1S/C23H24FN7OS/c1-22-6-7-23(2,30-22)19(24)16(9-22)31(3)18-12-26-20(29-28-18)15-5-4-13(8-17(15)32)21-27-11-14(10-25)33-21/h4-5,8,11-12,16,19,30,32H,6-7,9H2,1-3H3/t16-,19-,22-,23+/m0/s1 |
| InChIKey | VJFUHOAMVUBKRL-GJYWDZNJSA-N |
| XLogP | 3.69 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.56 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |