C24H27FN6OS — CID 167305438
2-[4-[6-[[(1R,2S,5R)-2-fluoro-5-methyl-5-propylcyclohexyl]-methylamino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1,3-thiazole-5-carbonitrile (PubChem CID 167305438) has the molecular formula C24H27FN6OS and a molecular weight of 466.59 g/mol. Its IUPAC name is 2-[4-[6-[[(1R,2S,5R)-2-fluoro-5-methyl-5-propylcyclohexyl]-methylamino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1,3-thiazole-5-carbonitrile.
| Compound Name | 2-[4-[6-[[(1R,2S,5R)-2-fluoro-5-methyl-5-propylcyclohexyl]-methylamino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1,3-thiazole-5-carbonitrile |
|---|---|
| PubChem CID | 167305438 |
| Molecular Formula | C24H27FN6OS |
| Molecular Weight | 466.59 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | 2-[4-[6-[[(1R,2S,5R)-2-fluoro-5-methyl-5-propylcyclohexyl]-methylamino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1,3-thiazole-5-carbonitrile |
| SMILES | CCC[C@]1(C)CC[C@H](F)[C@H](N(C)c2cnc(-c3ccc(-c4ncc(C#N)s4)cc3O)nn2)C1 |
| InChI | InChI=1S/C24H27FN6OS/c1-4-8-24(2)9-7-18(25)19(11-24)31(3)21-14-27-22(30-29-21)17-6-5-15(10-20(17)32)23-28-13-16(12-26)33-23/h5-6,10,13-14,18-19,32H,4,7-9,11H2,1-3H3/t18-,19+,24+/m0/s1 |
| InChIKey | KTKUAOQMYNXOEE-XLNZFTOWSA-N |
| XLogP | 5.37 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.59 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |