C28H33F2N5OS4 — CID 167301998
2-[6-[cyclopropyl-[(1R,2S,5R)-2-fluoro-5-methyl-5-propylcyclohexyl]amino]-1,2,4-triazin-3-yl]-5-[5-fluoro-2-[tris(sulfanyl)methylsulfanyl]-4-pyridinyl]phenol (PubChem CID 167301998) has the molecular formula C28H33F2N5OS4 and a molecular weight of 621.87 g/mol. Its IUPAC name is 2-[6-[cyclopropyl-[(1R,2S,5R)-2-fluoro-5-methyl-5-propylcyclohexyl]amino]-1,2,4-triazin-3-yl]-5-[5-fluoro-2-[tris(sulfanyl)methylsulfanyl]-4-pyridinyl]phenol.
| Compound Name | 2-[6-[cyclopropyl-[(1R,2S,5R)-2-fluoro-5-methyl-5-propylcyclohexyl]amino]-1,2,4-triazin-3-yl]-5-[5-fluoro-2-[tris(sulfanyl)methylsulfanyl]-4-pyridinyl]phenol |
|---|---|
| PubChem CID | 167301998 |
| Molecular Formula | C28H33F2N5OS4 |
| Molecular Weight | 621.87 g/mol |
| Exact Mass | 621.15 |
| IUPAC Name | 2-[6-[cyclopropyl-[(1R,2S,5R)-2-fluoro-5-methyl-5-propylcyclohexyl]amino]-1,2,4-triazin-3-yl]-5-[5-fluoro-2-[tris(sulfanyl)methylsulfanyl]-4-pyridinyl]phenol |
| SMILES | CCC[C@]1(C)CC[C@H](F)[C@H](N(c2cnc(-c3ccc(-c4cc(SC(S)(S)S)ncc4F)cc3O)nn2)C2CC2)C1 |
| InChI | InChI=1S/C28H33F2N5OS4/c1-3-9-27(2)10-8-20(29)22(13-27)35(17-5-6-17)24-15-32-26(34-33-24)18-7-4-16(11-23(18)36)19-12-25(31-14-21(19)30)40-28(37,38)39/h4,7,11-12,14-15,17,20,22,36-39H,3,5-6,8-10,13H2,1-2H3/t20-,22+,27+/m0/s1 |
| InChIKey | FJTZXACCFNGGPW-ZVUIFXONSA-N |
| XLogP | 7.60 |
| TPSA | 75.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.87 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|