C26H27F2N5OS4 — CID 167301943
2-[6-[cyclopropyl-[(1R,2S,3R,5S)-2-fluoro-3-bicyclo[3.2.1]octanyl]amino]-1,2,4-triazin-3-yl]-5-[2-fluoro-6-[tris(sulfanyl)methylsulfanyl]-4-pyridinyl]phenol (PubChem CID 167301943) has the molecular formula C26H27F2N5OS4 and a molecular weight of 591.80 g/mol. Its IUPAC name is 2-[6-[cyclopropyl-[(1R,2S,3R,5S)-2-fluoro-3-bicyclo[3.2.1]octanyl]amino]-1,2,4-triazin-3-yl]-5-[2-fluoro-6-[tris(sulfanyl)methylsulfanyl]-4-pyridinyl]phenol.
| Compound Name | 2-[6-[cyclopropyl-[(1R,2S,3R,5S)-2-fluoro-3-bicyclo[3.2.1]octanyl]amino]-1,2,4-triazin-3-yl]-5-[2-fluoro-6-[tris(sulfanyl)methylsulfanyl]-4-pyridinyl]phenol |
|---|---|
| PubChem CID | 167301943 |
| Molecular Formula | C26H27F2N5OS4 |
| Molecular Weight | 591.80 g/mol |
| Exact Mass | 591.11 |
| IUPAC Name | 2-[6-[cyclopropyl-[(1R,2S,3R,5S)-2-fluoro-3-bicyclo[3.2.1]octanyl]amino]-1,2,4-triazin-3-yl]-5-[2-fluoro-6-[tris(sulfanyl)methylsulfanyl]-4-pyridinyl]phenol |
| SMILES | Oc1cc(-c2cc(F)nc(SC(S)(S)S)c2)ccc1-c1ncc(N(C2CC2)[C@@H]2C[C@H]3CC[C@H](C3)[C@@H]2F)nn1 |
| InChI | InChI=1S/C26H27F2N5OS4/c27-21-10-16(11-23(30-21)38-26(35,36)37)14-3-6-18(20(34)9-14)25-29-12-22(31-32-25)33(17-4-5-17)19-8-13-1-2-15(7-13)24(19)28/h3,6,9-13,15,17,19,24,34-37H,1-2,4-5,7-8H2/t13-,15+,19+,24-/m0/s1 |
| InChIKey | HPHTYVRWJOUMIS-HPZPEJKZSA-N |
| XLogP | 6.43 |
| TPSA | 75.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.80 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|