C25H26F2N6OS — CID 166580963
2-[6-[cyclopropyl-[(1S,2S,3R,5S)-2-fluoro-8-azabicyclo[3.2.1]octan-3-yl]amino]-1,2,4-triazin-3-yl]-5-[2-fluoro-6-(trideuteriomethylsulfanyl)-4-pyridinyl]phenol (PubChem CID 166580963) has the molecular formula C25H26F2N6OS and a molecular weight of 499.61 g/mol. Its IUPAC name is 2-[6-[cyclopropyl-[(1S,2S,3R,5S)-2-fluoro-8-azabicyclo[3.2.1]octan-3-yl]amino]-1,2,4-triazin-3-yl]-5-[2-fluoro-6-(trideuteriomethylsulfanyl)-4-pyridinyl]phenol.
| Compound Name | 2-[6-[cyclopropyl-[(1S,2S,3R,5S)-2-fluoro-8-azabicyclo[3.2.1]octan-3-yl]amino]-1,2,4-triazin-3-yl]-5-[2-fluoro-6-(trideuteriomethylsulfanyl)-4-pyridinyl]phenol |
|---|---|
| PubChem CID | 166580963 |
| Molecular Formula | C25H26F2N6OS |
| Molecular Weight | 499.61 g/mol |
| Exact Mass | 499.20 |
| IUPAC Name | 2-[6-[cyclopropyl-[(1S,2S,3R,5S)-2-fluoro-8-azabicyclo[3.2.1]octan-3-yl]amino]-1,2,4-triazin-3-yl]-5-[2-fluoro-6-(trideuteriomethylsulfanyl)-4-pyridinyl]phenol |
| SMILES | [2H]C([2H])([2H])Sc1cc(-c2ccc(-c3ncc(N(C4CC4)[C@@H]4C[C@@H]5CC[C@H](N5)[C@@H]4F)nn3)c(O)c2)cc(F)n1 |
| InChI | InChI=1S/C25H26F2N6OS/c1-35-23-10-14(9-21(26)30-23)13-2-6-17(20(34)8-13)25-28-12-22(31-32-25)33(16-4-5-16)19-11-15-3-7-18(29-15)24(19)27/h2,6,8-10,12,15-16,18-19,24,29,34H,3-5,7,11H2,1H3/t15-,18-,19+,24-/m0/s1/i1D3 |
| InChIKey | BPRXDNWCDVPQMD-OPTIAYJVSA-N |
| XLogP | 4.37 |
| TPSA | 87.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.61 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|