C28H32F2N6OS — CID 166580841
2-[6-[cyclopropyl-[(1R,2S,3S,5S)-2-fluoro-1,5-dimethyl-9-azabicyclo[3.3.1]nonan-3-yl]amino]-1,2,4-triazin-3-yl]-5-[2-fluoro-6-(trideuteriomethylsulfanyl)-4-pyridinyl]phenol (PubChem CID 166580841) has the molecular formula C28H32F2N6OS and a molecular weight of 541.69 g/mol. Its IUPAC name is 2-[6-[cyclopropyl-[(1R,2S,3S,5S)-2-fluoro-1,5-dimethyl-9-azabicyclo[3.3.1]nonan-3-yl]amino]-1,2,4-triazin-3-yl]-5-[2-fluoro-6-(trideuteriomethylsulfanyl)-4-pyridinyl]phenol.
| Compound Name | 2-[6-[cyclopropyl-[(1R,2S,3S,5S)-2-fluoro-1,5-dimethyl-9-azabicyclo[3.3.1]nonan-3-yl]amino]-1,2,4-triazin-3-yl]-5-[2-fluoro-6-(trideuteriomethylsulfanyl)-4-pyridinyl]phenol |
|---|---|
| PubChem CID | 166580841 |
| Molecular Formula | C28H32F2N6OS |
| Molecular Weight | 541.69 g/mol |
| Exact Mass | 541.25 |
| IUPAC Name | 2-[6-[cyclopropyl-[(1R,2S,3S,5S)-2-fluoro-1,5-dimethyl-9-azabicyclo[3.3.1]nonan-3-yl]amino]-1,2,4-triazin-3-yl]-5-[2-fluoro-6-(trideuteriomethylsulfanyl)-4-pyridinyl]phenol |
| SMILES | [2H]C([2H])([2H])Sc1cc(-c2ccc(-c3ncc(N(C4CC4)[C@H]4C[C@]5(C)CCC[C@@](C)(N5)[C@H]4F)nn3)c(O)c2)cc(F)n1 |
| InChI | InChI=1S/C28H32F2N6OS/c1-27-9-4-10-28(2,35-27)25(30)20(14-27)36(18-6-7-18)23-15-31-26(34-33-23)19-8-5-16(11-21(19)37)17-12-22(29)32-24(13-17)38-3/h5,8,11-13,15,18,20,25,35,37H,4,6-7,9-10,14H2,1-3H3/t20-,25-,27-,28+/m0/s1/i3D3 |
| InChIKey | CANMLRVPVXZGDN-CWPNPJBASA-N |
| XLogP | 5.54 |
| TPSA | 87.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.69 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|