C27H30F2N6O2 — CID 166580824
2-[6-[cyclopropyl-[(1S,2R,3R,5R)-2-fluoro-1,5-dimethyl-8-azabicyclo[3.2.1]octan-3-yl]amino]-1,2,4-triazin-3-yl]-5-[2-fluoro-6-(trideuteriomethoxy)-4-pyridinyl]phenol (PubChem CID 166580824) has the molecular formula C27H30F2N6O2 and a molecular weight of 511.59 g/mol. Its IUPAC name is 2-[6-[cyclopropyl-[(1S,2R,3R,5R)-2-fluoro-1,5-dimethyl-8-azabicyclo[3.2.1]octan-3-yl]amino]-1,2,4-triazin-3-yl]-5-[2-fluoro-6-(trideuteriomethoxy)-4-pyridinyl]phenol.
| Compound Name | 2-[6-[cyclopropyl-[(1S,2R,3R,5R)-2-fluoro-1,5-dimethyl-8-azabicyclo[3.2.1]octan-3-yl]amino]-1,2,4-triazin-3-yl]-5-[2-fluoro-6-(trideuteriomethoxy)-4-pyridinyl]phenol |
|---|---|
| PubChem CID | 166580824 |
| Molecular Formula | C27H30F2N6O2 |
| Molecular Weight | 511.59 g/mol |
| Exact Mass | 511.26 |
| IUPAC Name | 2-[6-[cyclopropyl-[(1S,2R,3R,5R)-2-fluoro-1,5-dimethyl-8-azabicyclo[3.2.1]octan-3-yl]amino]-1,2,4-triazin-3-yl]-5-[2-fluoro-6-(trideuteriomethoxy)-4-pyridinyl]phenol |
| SMILES | [2H]C([2H])([2H])Oc1cc(-c2ccc(-c3ncc(N(C4CC4)[C@@H]4C[C@@]5(C)CC[C@](C)(N5)[C@@H]4F)nn3)c(O)c2)cc(F)n1 |
| InChI | InChI=1S/C27H30F2N6O2/c1-26-8-9-27(2,34-26)24(29)19(13-26)35(17-5-6-17)22-14-30-25(33-32-22)18-7-4-15(10-20(18)36)16-11-21(28)31-23(12-16)37-3/h4,7,10-12,14,17,19,24,34,36H,5-6,8-9,13H2,1-3H3/t19-,24-,26-,27+/m1/s1/i3D3 |
| InChIKey | XGBMUWOGRIQYIP-VJTKEPJNSA-N |
| XLogP | 4.43 |
| TPSA | 96.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.59 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|