C28H32F2N6O2 — CID 167319313
2-[3-[cyclopropyl-[(1R,2S,3S,5S)-2-fluoro-1,5-dimethyl-9-azabicyclo[3.3.1]nonan-3-yl]amino]-1,2,4-triazin-6-yl]-5-(2-fluoro-6-methoxy-4-pyridinyl)phenol (PubChem CID 167319313) has the molecular formula C28H32F2N6O2 and a molecular weight of 522.60 g/mol. Its IUPAC name is 2-[3-[cyclopropyl-[(1R,2S,3S,5S)-2-fluoro-1,5-dimethyl-9-azabicyclo[3.3.1]nonan-3-yl]amino]-1,2,4-triazin-6-yl]-5-(2-fluoro-6-methoxy-4-pyridinyl)phenol.
| Compound Name | 2-[3-[cyclopropyl-[(1R,2S,3S,5S)-2-fluoro-1,5-dimethyl-9-azabicyclo[3.3.1]nonan-3-yl]amino]-1,2,4-triazin-6-yl]-5-(2-fluoro-6-methoxy-4-pyridinyl)phenol |
|---|---|
| PubChem CID | 167319313 |
| Molecular Formula | C28H32F2N6O2 |
| Molecular Weight | 522.60 g/mol |
| Exact Mass | 522.26 |
| IUPAC Name | 2-[3-[cyclopropyl-[(1R,2S,3S,5S)-2-fluoro-1,5-dimethyl-9-azabicyclo[3.3.1]nonan-3-yl]amino]-1,2,4-triazin-6-yl]-5-(2-fluoro-6-methoxy-4-pyridinyl)phenol |
| SMILES | COc1cc(-c2ccc(-c3cnc(N(C4CC4)[C@H]4C[C@]5(C)CCC[C@@](C)(N5)[C@H]4F)nn3)c(O)c2)cc(F)n1 |
| InChI | InChI=1S/C28H32F2N6O2/c1-27-9-4-10-28(2,35-27)25(30)21(14-27)36(18-6-7-18)26-31-15-20(33-34-26)19-8-5-16(11-22(19)37)17-12-23(29)32-24(13-17)38-3/h5,8,11-13,15,18,21,25,35,37H,4,6-7,9-10,14H2,1-3H3/t21-,25-,27-,28+/m0/s1 |
| InChIKey | KWJRUKASXFAHDW-NWCUEOPASA-N |
| XLogP | 4.82 |
| TPSA | 96.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.60 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|