C27H32FN7O2 — CID 167319274
2-[3-[cyclopropyl-[(1R,2S,3S,5S)-2-fluoro-1,5-dimethyl-8-azabicyclo[3.2.1]octan-3-yl]amino]-1,2,4-triazin-6-yl]-5-(5-methoxy-6-methylpyridazin-3-yl)phenol (PubChem CID 167319274) has the molecular formula C27H32FN7O2 and a molecular weight of 505.60 g/mol. Its IUPAC name is 2-[3-[cyclopropyl-[(1R,2S,3S,5S)-2-fluoro-1,5-dimethyl-8-azabicyclo[3.2.1]octan-3-yl]amino]-1,2,4-triazin-6-yl]-5-(5-methoxy-6-methylpyridazin-3-yl)phenol.
| Compound Name | 2-[3-[cyclopropyl-[(1R,2S,3S,5S)-2-fluoro-1,5-dimethyl-8-azabicyclo[3.2.1]octan-3-yl]amino]-1,2,4-triazin-6-yl]-5-(5-methoxy-6-methylpyridazin-3-yl)phenol |
|---|---|
| PubChem CID | 167319274 |
| Molecular Formula | C27H32FN7O2 |
| Molecular Weight | 505.60 g/mol |
| Exact Mass | 505.26 |
| IUPAC Name | 2-[3-[cyclopropyl-[(1R,2S,3S,5S)-2-fluoro-1,5-dimethyl-8-azabicyclo[3.2.1]octan-3-yl]amino]-1,2,4-triazin-6-yl]-5-(5-methoxy-6-methylpyridazin-3-yl)phenol |
| SMILES | COc1cc(-c2ccc(-c3cnc(N(C4CC4)[C@H]4C[C@]5(C)CC[C@@](C)(N5)[C@H]4F)nn3)c(O)c2)nnc1C |
| InChI | InChI=1S/C27H32FN7O2/c1-15-23(37-4)12-19(31-30-15)16-5-8-18(22(36)11-16)20-14-29-25(33-32-20)35(17-6-7-17)21-13-26(2)9-10-27(3,34-26)24(21)28/h5,8,11-12,14,17,21,24,34,36H,6-7,9-10,13H2,1-4H3/t21-,24-,26-,27+/m0/s1 |
| InChIKey | OATCZAKNXKQBHW-FOEQRGQYSA-N |
| XLogP | 4.00 |
| TPSA | 109.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.60 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |