C25H26FN7OS — CID 167318987
4-[4-[3-[cyclopropyl-[(1R,2S,3S,5S)-2-fluoro-1,5-dimethyl-8-azabicyclo[3.2.1]octan-3-yl]amino]-1,2,4-triazin-6-yl]-3-hydroxyphenyl]-1,3-thiazole-2-carbonitrile (PubChem CID 167318987) has the molecular formula C25H26FN7OS and a molecular weight of 491.60 g/mol. Its IUPAC name is 4-[4-[3-[cyclopropyl-[(1R,2S,3S,5S)-2-fluoro-1,5-dimethyl-8-azabicyclo[3.2.1]octan-3-yl]amino]-1,2,4-triazin-6-yl]-3-hydroxyphenyl]-1,3-thiazole-2-carbonitrile.
| Compound Name | 4-[4-[3-[cyclopropyl-[(1R,2S,3S,5S)-2-fluoro-1,5-dimethyl-8-azabicyclo[3.2.1]octan-3-yl]amino]-1,2,4-triazin-6-yl]-3-hydroxyphenyl]-1,3-thiazole-2-carbonitrile |
|---|---|
| PubChem CID | 167318987 |
| Molecular Formula | C25H26FN7OS |
| Molecular Weight | 491.60 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | 4-[4-[3-[cyclopropyl-[(1R,2S,3S,5S)-2-fluoro-1,5-dimethyl-8-azabicyclo[3.2.1]octan-3-yl]amino]-1,2,4-triazin-6-yl]-3-hydroxyphenyl]-1,3-thiazole-2-carbonitrile |
| SMILES | C[C@@]12CC[C@@](C)(N1)[C@@H](F)[C@@H](N(c1ncc(-c3ccc(-c4csc(C#N)n4)cc3O)nn1)C1CC1)C2 |
| InChI | InChI=1S/C25H26FN7OS/c1-24-7-8-25(2,32-24)22(26)19(10-24)33(15-4-5-15)23-28-12-17(30-31-23)16-6-3-14(9-20(16)34)18-13-35-21(11-27)29-18/h3,6,9,12-13,15,19,22,32,34H,4-5,7-8,10H2,1-2H3/t19-,22-,24-,25+/m0/s1 |
| InChIKey | VSBUNQWNYKGMCP-JFTIDPPCSA-N |
| XLogP | 4.22 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.60 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |