C24H26FN9O — CID 166580791
1-[4-[6-[cyclopropyl-[(1S,2R,3R,5R)-2-fluoro-1,5-dimethyl-8-azabicyclo[3.2.1]octan-3-yl]amino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]triazole-4-carbonitrile (PubChem CID 166580791) has the molecular formula C24H26FN9O and a molecular weight of 475.53 g/mol. Its IUPAC name is 1-[4-[6-[cyclopropyl-[(1S,2R,3R,5R)-2-fluoro-1,5-dimethyl-8-azabicyclo[3.2.1]octan-3-yl]amino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]triazole-4-carbonitrile.
| Compound Name | 1-[4-[6-[cyclopropyl-[(1S,2R,3R,5R)-2-fluoro-1,5-dimethyl-8-azabicyclo[3.2.1]octan-3-yl]amino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]triazole-4-carbonitrile |
|---|---|
| PubChem CID | 166580791 |
| Molecular Formula | C24H26FN9O |
| Molecular Weight | 475.53 g/mol |
| Exact Mass | 475.22 |
| IUPAC Name | 1-[4-[6-[cyclopropyl-[(1S,2R,3R,5R)-2-fluoro-1,5-dimethyl-8-azabicyclo[3.2.1]octan-3-yl]amino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]triazole-4-carbonitrile |
| SMILES | C[C@]12CC[C@](C)(N1)[C@H](F)[C@H](N(c1cnc(-c3ccc(-n4cc(C#N)nn4)cc3O)nn1)C1CC1)C2 |
| InChI | InChI=1S/C24H26FN9O/c1-23-7-8-24(2,31-23)21(25)18(10-23)34(15-3-4-15)20-12-27-22(30-29-20)17-6-5-16(9-19(17)35)33-13-14(11-26)28-32-33/h5-6,9,12-13,15,18,21,31,35H,3-4,7-8,10H2,1-2H3/t18-,21-,23-,24+/m1/s1 |
| InChIKey | BSIGYPGCGAENHL-ABZSKANCSA-N |
| XLogP | 2.68 |
| TPSA | 128.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.53 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |