C23H25FN8O — CID 167306185
1-[4-[6-[[(1R,3S,4R,5S)-4-fluoro-1-methyl-3-bicyclo[3.3.1]nonanyl]-methylamino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]triazole-4-carbonitrile (PubChem CID 167306185) has the molecular formula C23H25FN8O and a molecular weight of 448.51 g/mol. Its IUPAC name is 1-[4-[6-[[(1R,3S,4R,5S)-4-fluoro-1-methyl-3-bicyclo[3.3.1]nonanyl]-methylamino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]triazole-4-carbonitrile.
| Compound Name | 1-[4-[6-[[(1R,3S,4R,5S)-4-fluoro-1-methyl-3-bicyclo[3.3.1]nonanyl]-methylamino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]triazole-4-carbonitrile |
|---|---|
| PubChem CID | 167306185 |
| Molecular Formula | C23H25FN8O |
| Molecular Weight | 448.51 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | 1-[4-[6-[[(1R,3S,4R,5S)-4-fluoro-1-methyl-3-bicyclo[3.3.1]nonanyl]-methylamino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]triazole-4-carbonitrile |
| SMILES | CN(c1cnc(-c2ccc(-n3cc(C#N)nn3)cc2O)nn1)[C@H]1C[C@]2(C)CCC[C@@H](C2)[C@H]1F |
| InChI | InChI=1S/C23H25FN8O/c1-23-7-3-4-14(9-23)21(24)18(10-23)31(2)20-12-26-22(29-28-20)17-6-5-16(8-19(17)33)32-13-15(11-25)27-30-32/h5-6,8,12-14,18,21,33H,3-4,7,9-10H2,1-2H3/t14-,18-,21+,23+/m0/s1 |
| InChIKey | WBDRDHWTYMOFPE-VMRKRFJUSA-N |
| XLogP | 3.44 |
| TPSA | 116.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.51 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |