C25H26FN7OS — CID 167302245
5-[4-[6-[cyclopropyl-[(1S,3R,4S,5R)-4-fluoro-1-methyl-3-bicyclo[3.3.1]nonanyl]amino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1,3,4-thiadiazole-2-carbonitrile (PubChem CID 167302245) has the molecular formula C25H26FN7OS and a molecular weight of 491.60 g/mol. Its IUPAC name is 5-[4-[6-[cyclopropyl-[(1S,3R,4S,5R)-4-fluoro-1-methyl-3-bicyclo[3.3.1]nonanyl]amino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1,3,4-thiadiazole-2-carbonitrile.
| Compound Name | 5-[4-[6-[cyclopropyl-[(1S,3R,4S,5R)-4-fluoro-1-methyl-3-bicyclo[3.3.1]nonanyl]amino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1,3,4-thiadiazole-2-carbonitrile |
|---|---|
| PubChem CID | 167302245 |
| Molecular Formula | C25H26FN7OS |
| Molecular Weight | 491.60 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | 5-[4-[6-[cyclopropyl-[(1S,3R,4S,5R)-4-fluoro-1-methyl-3-bicyclo[3.3.1]nonanyl]amino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1,3,4-thiadiazole-2-carbonitrile |
| SMILES | C[C@]12CCC[C@H](C1)[C@H](F)[C@H](N(c1cnc(-c3ccc(-c4nnc(C#N)s4)cc3O)nn1)C1CC1)C2 |
| InChI | InChI=1S/C25H26FN7OS/c1-25-8-2-3-15(10-25)22(26)18(11-25)33(16-5-6-16)20-13-28-23(31-29-20)17-7-4-14(9-19(17)34)24-32-30-21(12-27)35-24/h4,7,9,13,15-16,18,22,34H,2-3,5-6,8,10-11H2,1H3/t15-,18-,22+,25+/m1/s1 |
| InChIKey | HHSSQXCSFLEFMO-IWYGRFOWSA-N |
| XLogP | 4.91 |
| TPSA | 111.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.60 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |