C22H22N8OS — CID 167301800
5-[4-[6-[[(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl]-cyclopropylamino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1,3,4-thiadiazole-2-carbonitrile (PubChem CID 167301800) has the molecular formula C22H22N8OS and a molecular weight of 446.54 g/mol. Its IUPAC name is 5-[4-[6-[[(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl]-cyclopropylamino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1,3,4-thiadiazole-2-carbonitrile.
| Compound Name | 5-[4-[6-[[(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl]-cyclopropylamino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1,3,4-thiadiazole-2-carbonitrile |
|---|---|
| PubChem CID | 167301800 |
| Molecular Formula | C22H22N8OS |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | 5-[4-[6-[[(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl]-cyclopropylamino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1,3,4-thiadiazole-2-carbonitrile |
| SMILES | N#Cc1nnc(-c2ccc(-c3ncc(N(C4CC4)C4C[C@H]5CC[C@@H](C4)N5)nn3)c(O)c2)s1 |
| InChI | InChI=1S/C22H22N8OS/c23-10-20-27-29-22(32-20)12-1-6-17(18(31)7-12)21-24-11-19(26-28-21)30(15-4-5-15)16-8-13-2-3-14(9-16)25-13/h1,6-7,11,13-16,25,31H,2-5,8-9H2/t13-,14+,16? |
| InChIKey | DRAIVPCNUCHDGO-MZBDJJRSSA-N |
| XLogP | 2.89 |
| TPSA | 123.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |