C24H25FN6OS — CID 174033287
2-[4-[6-[cyclopropyl-[(1R,2S,5R)-5-ethyl-2-fluorocyclohexyl]amino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1,3-thiazole-5-carbonitrile (PubChem CID 174033287) has the molecular formula C24H25FN6OS and a molecular weight of 464.57 g/mol. Its IUPAC name is 2-[4-[6-[cyclopropyl-[(1R,2S,5R)-5-ethyl-2-fluorocyclohexyl]amino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1,3-thiazole-5-carbonitrile.
| Compound Name | 2-[4-[6-[cyclopropyl-[(1R,2S,5R)-5-ethyl-2-fluorocyclohexyl]amino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1,3-thiazole-5-carbonitrile |
|---|---|
| PubChem CID | 174033287 |
| Molecular Formula | C24H25FN6OS |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | 2-[4-[6-[cyclopropyl-[(1R,2S,5R)-5-ethyl-2-fluorocyclohexyl]amino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1,3-thiazole-5-carbonitrile |
| SMILES | CC[C@@H]1CC[C@H](F)[C@H](N(c2cnc(-c3ccc(-c4ncc(C#N)s4)cc3O)nn2)C2CC2)C1 |
| InChI | InChI=1S/C24H25FN6OS/c1-2-14-3-8-19(25)20(9-14)31(16-5-6-16)22-13-27-23(30-29-22)18-7-4-15(10-21(18)32)24-28-12-17(11-26)33-24/h4,7,10,12-14,16,19-20,32H,2-3,5-6,8-9H2,1H3/t14-,19+,20-/m1/s1 |
| InChIKey | RNIMITMVGSIFNC-VOBQZIQPSA-N |
| XLogP | 5.12 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |